About [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane
[(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102233872) has the molecular formula C16H33BrOSi
and a molecular weight of 349.43 g/mol. Its IUPAC name is [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane |
| PubChem CID | 102233872 |
| Molecular Formula | C16H33BrOSi |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)=CCC[C@](C)(CCBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33BrOSi/c1-14(2)10-9-11-16(6,12-13-17)18-19(7,8)15(3,4)5/h10H,9,11-13H2,1-8H3/t16-/m1/s1 |
| InChIKey | QBXFGGNUZNKNGZ-MRXNPFEDSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane?
The IUPAC name of [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane (CID 102233872) is [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane?
The canonical SMILES for [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane is CC(C)=CCC[C@](C)(CCBr)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane?
The InChIKey is QBXFGGNUZNKNGZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H33BrOSi/c1-14(2)10-9-11-16(6,12-13-17)18-19(7,8)15(3,4)5/h10H,9,11-13H2,1-8H3/t16-/m1/s1.
What are the key properties of [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane?
[(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane has a molecular weight of 349.43 g/mol, XLogP of 6.30, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-bromo-3,7-dimethyloct-6-en-3-yl]oxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 102233872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).