C12H29NOSi — CID 163618882
2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-amine (PubChem CID 163618882) has the molecular formula C12H29NOSi and a molecular weight of 231.46 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-amine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 163618882 |
| Molecular Formula | C12H29NOSi |
| Molecular Weight | 231.46 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)C(C)(N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H29NOSi/c1-10(2,3)12(7,13)14-15(8,9)11(4,5)6/h13H2,1-9H3 |
| InChIKey | HMJNMBBWMQZPME-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|