C16H36O3Si2 — CID 86745388
tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;but-2-yne-1,4-diol (PubChem CID 86745388) has the molecular formula C16H36O3Si2 and a molecular weight of 332.63 g/mol. Its IUPAC name is tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;but-2-yne-1,4-diol.
| Compound Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;but-2-yne-1,4-diol |
|---|---|
| PubChem CID | 86745388 |
| Molecular Formula | C16H36O3Si2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane;but-2-yne-1,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C.OCC#CCO |
| InChI | InChI=1S/C12H30OSi2.C4H6O2/c1-11(2,3)14(7,8)13-15(9,10)12(4,5)6;5-3-1-2-4-6/h1-10H3;5-6H,3-4H2 |
| InChIKey | QVYIVJNBQIPLAA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|