C13H26O2Si — CID 10399504
5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypent-2-yn-1-ol (PubChem CID 10399504) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypent-2-yn-1-ol.
| Compound Name | 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypent-2-yn-1-ol |
|---|---|
| PubChem CID | 10399504 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypent-2-yn-1-ol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCCC#CCO |
| InChI | InChI=1S/C13H26O2Si/c1-12(2)13(3,4)16(5,6)15-11-9-7-8-10-14/h12,14H,9-11H2,1-6H3 |
| InChIKey | HQKBPBXSIOUFJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|