C16H27BrOSi — CID 14257862
2-(4-bromophenyl)ethoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane (PubChem CID 14257862) has the molecular formula C16H27BrOSi and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(4-bromophenyl)ethoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane.
| Compound Name | 2-(4-bromophenyl)ethoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 14257862 |
| Molecular Formula | C16H27BrOSi |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(4-bromophenyl)ethoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H27BrOSi/c1-13(2)16(3,4)19(5,6)18-12-11-14-7-9-15(17)10-8-14/h7-10,13H,11-12H2,1-6H3 |
| InChIKey | XLVKZCYMUMEOHG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|