C13H21BrOSi — CID 10859583
(4-bromophenyl)methoxy-tert-butyl-dimethylsilane (PubChem CID 10859583) has the molecular formula C13H21BrOSi and a molecular weight of 301.30 g/mol. Its IUPAC name is (4-bromophenyl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (4-bromophenyl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10859583 |
| Molecular Formula | C13H21BrOSi |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (4-bromophenyl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H21BrOSi/c1-13(2,3)16(4,5)15-10-11-6-8-12(14)9-7-11/h6-9H,10H2,1-5H3 |
| InChIKey | OURCJXVOBHLREF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|