C13H21IOSi — CID 10020633
tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane (PubChem CID 10020633) has the molecular formula C13H21IOSi and a molecular weight of 348.30 g/mol. Its IUPAC name is tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10020633 |
| Molecular Formula | C13H21IOSi |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | tert-butyl-[(4-iodophenyl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C13H21IOSi/c1-13(2,3)16(4,5)15-10-11-6-8-12(14)9-7-11/h6-9H,10H2,1-5H3 |
| InChIKey | HJACHJOGIDAXCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|