C36H60O6Si2 — CID 76826455
tert-butyl-[[4-[2-[4-[2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]ethoxy]but-2-enoxy]ethoxymethyl]phenyl]methoxy]-dimethylsilane (PubChem CID 76826455) has the molecular formula C36H60O6Si2 and a molecular weight of 645.04 g/mol. Its IUPAC name is tert-butyl-[[4-[2-[4-[2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]ethoxy]but-2-enoxy]ethoxymethyl]phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-[2-[4-[2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]ethoxy]but-2-enoxy]ethoxymethyl]phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 76826455 |
| Molecular Formula | C36H60O6Si2 |
| Molecular Weight | 645.04 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | tert-butyl-[[4-[2-[4-[2-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]ethoxy]but-2-enoxy]ethoxymethyl]phenyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(COCCOCC=CCOCCOCc2ccc(CO[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H60O6Si2/c1-35(2,3)43(7,8)41-29-33-17-13-31(14-18-33)27-39-25-23-37-21-11-12-22-38-24-26-40-28-32-15-19-34(20-16-32)30-42-44(9,10)36(4,5)6/h11-20H,21-30H2,1-10H3 |
| InChIKey | GNAMMXUNDBQPOH-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.04 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|