C17H25F3O2Si — CID 159418209
4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,1,1-trifluorobutan-2-one (PubChem CID 159418209) has the molecular formula C17H25F3O2Si and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,1,1-trifluorobutan-2-one.
| Compound Name | 4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,1,1-trifluorobutan-2-one |
|---|---|
| PubChem CID | 159418209 |
| Molecular Formula | C17H25F3O2Si |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1,1,1-trifluorobutan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(CCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3O2Si/c1-16(2,3)23(4,5)22-12-14-8-6-13(7-9-14)10-11-15(21)17(18,19)20/h6-9H,10-12H2,1-5H3 |
| InChIKey | YBTUANXLAULJIE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|