C12H13F3O2 — CID 59202399
4-(4-ethoxyphenyl)-1,1,1-trifluorobutan-2-one (PubChem CID 59202399) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-1,1,1-trifluorobutan-2-one.
| Compound Name | 4-(4-ethoxyphenyl)-1,1,1-trifluorobutan-2-one |
|---|---|
| PubChem CID | 59202399 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-(4-ethoxyphenyl)-1,1,1-trifluorobutan-2-one |
| SMILES | CCOc1ccc(CCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O2/c1-2-17-10-6-3-9(4-7-10)5-8-11(16)12(13,14)15/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | PLNAOAABORJFGR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |