C16H19F3O4 — CID 57301381
tert-butyl 2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]acetate (PubChem CID 57301381) has the molecular formula C16H19F3O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is tert-butyl 2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]acetate |
|---|---|
| PubChem CID | 57301381 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | tert-butyl 2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(CCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3O4/c1-15(2,3)23-14(21)10-22-12-7-4-11(5-8-12)6-9-13(20)16(17,18)19/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | SNQLKIOXWUDKJZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |