C12H12BrF3O2 — CID 18319108
4-[4-(2-bromoethoxy)phenyl]-1,1,1-trifluorobutan-2-one (PubChem CID 18319108) has the molecular formula C12H12BrF3O2 and a molecular weight of 325.12 g/mol. Its IUPAC name is 4-[4-(2-bromoethoxy)phenyl]-1,1,1-trifluorobutan-2-one.
| Compound Name | 4-[4-(2-bromoethoxy)phenyl]-1,1,1-trifluorobutan-2-one |
|---|---|
| PubChem CID | 18319108 |
| Molecular Formula | C12H12BrF3O2 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-[4-(2-bromoethoxy)phenyl]-1,1,1-trifluorobutan-2-one |
| SMILES | O=C(CCc1ccc(OCCBr)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O2/c13-7-8-18-10-4-1-9(2-5-10)3-6-11(17)12(14,15)16/h1-2,4-5H,3,6-8H2 |
| InChIKey | QWYMXNAUPGPXJC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|