C14H13F3O5 — CID 70149800
3-oxo-4-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]butanoic acid (PubChem CID 70149800) has the molecular formula C14H13F3O5 and a molecular weight of 318.25 g/mol. Its IUPAC name is 3-oxo-4-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]butanoic acid.
| Compound Name | 3-oxo-4-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 70149800 |
| Molecular Formula | C14H13F3O5 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-oxo-4-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CC(=O)COc1ccc(CCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3O5/c15-14(16,17)12(19)6-3-9-1-4-11(5-2-9)22-8-10(18)7-13(20)21/h1-2,4-5H,3,6-8H2,(H,20,21) |
| InChIKey | MZKOLWNMJZSMJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|