C13H15F3O3 — CID 22949849
1,1,1-trifluoro-4-[4-(3-hydroxypropoxy)phenyl]butan-2-one (PubChem CID 22949849) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[4-(3-hydroxypropoxy)phenyl]butan-2-one.
| Compound Name | 1,1,1-trifluoro-4-[4-(3-hydroxypropoxy)phenyl]butan-2-one |
|---|---|
| PubChem CID | 22949849 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1,1,1-trifluoro-4-[4-(3-hydroxypropoxy)phenyl]butan-2-one |
| SMILES | O=C(CCc1ccc(OCCCO)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3/c14-13(15,16)12(18)7-4-10-2-5-11(6-3-10)19-9-1-8-17/h2-3,5-6,17H,1,4,7-9H2 |
| InChIKey | PAGRLZBLMYJEKE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|