C12H18N2O2 — CID 116846343
3-(4-ethoxyphenyl)-N'-methylpropanehydrazide (PubChem CID 116846343) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-N'-methylpropanehydrazide.
| Compound Name | 3-(4-ethoxyphenyl)-N'-methylpropanehydrazide |
|---|---|
| PubChem CID | 116846343 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-(4-ethoxyphenyl)-N'-methylpropanehydrazide |
| SMILES | CCOc1ccc(CCC(=O)NNC)cc1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-16-11-7-4-10(5-8-11)6-9-12(15)14-13-2/h4-5,7-8,13H,3,6,9H2,1-2H3,(H,14,15) |
| InChIKey | CINPLZXVGMMBJD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|