C17H28O5Si — CID 90798603
acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate (PubChem CID 90798603) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate.
| Compound Name | acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 90798603 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate |
| SMILES | CC(=O)O.CC(=O)Oc1ccc(CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O3Si.C2H4O2/c1-12(16)18-14-9-7-13(8-10-14)11-17-19(5,6)15(2,3)4;1-2(3)4/h7-10H,11H2,1-6H3;1H3,(H,3,4) |
| InChIKey | QOZLOKNVEIQLFS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|