C23H30O4Si — CID 139770385
(E)-3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]phenyl]-2-methylprop-2-enoic acid (PubChem CID 139770385) has the molecular formula C23H30O4Si and a molecular weight of 398.58 g/mol. Its IUPAC name is (E)-3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 139770385 |
| Molecular Formula | C23H30O4Si |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (E)-3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cccc(Oc2ccc(CO[Si](C)(C)C(C)(C)C)cc2)c1)C(=O)O |
| InChI | InChI=1S/C23H30O4Si/c1-17(22(24)25)14-19-8-7-9-21(15-19)27-20-12-10-18(11-13-20)16-26-28(5,6)23(2,3)4/h7-15H,16H2,1-6H3,(H,24,25)/b17-14+ |
| InChIKey | OXSXZRLHYOLIHY-SAPNQHFASA-N |
| XLogP | 6.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|