C25H38O6Si — CID 162188158
acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate;4-ethylphenol (PubChem CID 162188158) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate;4-ethylphenol.
| Compound Name | acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate;4-ethylphenol |
|---|---|
| PubChem CID | 162188158 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | acetic acid;[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl] acetate;4-ethylphenol |
| SMILES | CC(=O)O.CC(=O)Oc1ccc(CO[Si](C)(C)C(C)(C)C)cc1.CCc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24O3Si.C8H10O.C2H4O2/c1-12(16)18-14-9-7-13(8-10-14)11-17-19(5,6)15(2,3)4;1-2-7-3-5-8(9)6-4-7;1-2(3)4/h7-10H,11H2,1-6H3;3-6,9H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | UJFBDWRUNUHZRD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|