C19H32O4Si — CID 67588790
ethyl 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]butanoate (PubChem CID 67588790) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is ethyl 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]butanoate.
| Compound Name | ethyl 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 67588790 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | ethyl 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc(CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32O4Si/c1-8-17(18(20)21-9-2)23-16-12-10-15(11-13-16)14-22-24(6,7)19(3,4)5/h10-13,17H,8-9,14H2,1-7H3 |
| InChIKey | YDUGLXREIWAABE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|