C20H32O4Si — CID 68995900
ethyl (Z)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-ethoxyprop-2-enoate (PubChem CID 68995900) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-ethoxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 68995900 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | ethyl (Z)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-ethoxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(CO[Si](C)(C)C(C)(C)C)cc1)OCC |
| InChI | InChI=1S/C20H32O4Si/c1-8-22-18(19(21)23-9-2)14-16-10-12-17(13-11-16)15-24-25(6,7)20(3,4)5/h10-14H,8-9,15H2,1-7H3/b18-14- |
| InChIKey | ZBAYBKDJWRTXAG-JXAWBTAJSA-N |
| XLogP | 5.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|