C18H27FO3Si — CID 174032298
ethyl (E)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]prop-2-enoate (PubChem CID 174032298) has the molecular formula C18H27FO3Si and a molecular weight of 338.50 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 174032298 |
| Molecular Formula | C18H27FO3Si |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | ethyl (E)-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(CO[Si](C)(C)C(C)(C)C)cc1F |
| InChI | InChI=1S/C18H27FO3Si/c1-7-21-17(20)11-10-15-9-8-14(12-16(15)19)13-22-23(5,6)18(2,3)4/h8-12H,7,13H2,1-6H3/b11-10+ |
| InChIKey | ZYOLSYBMBGSVHS-ZHACJKMWSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|