C13H19F3OSi — CID 91735449
tert-butyl-dimethyl-[(3,4,5-trifluorophenyl)methoxy]silane (PubChem CID 91735449) has the molecular formula C13H19F3OSi and a molecular weight of 276.37 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3,4,5-trifluorophenyl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3,4,5-trifluorophenyl)methoxy]silane |
|---|---|
| PubChem CID | 91735449 |
| Molecular Formula | C13H19F3OSi |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | tert-butyl-dimethyl-[(3,4,5-trifluorophenyl)methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H19F3OSi/c1-13(2,3)18(4,5)17-8-9-6-10(14)12(16)11(15)7-9/h6-7H,8H2,1-5H3 |
| InChIKey | JFAQZTKVYNRODI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|