C14H19F2NOSi — CID 161218423
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-difluorobenzonitrile (PubChem CID 161218423) has the molecular formula C14H19F2NOSi and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 161218423 |
| Molecular Formula | C14H19F2NOSi |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-difluorobenzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C14H19F2NOSi/c1-14(2,3)19(4,5)18-9-10-6-12(15)11(8-17)13(16)7-10/h6-7H,9H2,1-5H3 |
| InChIKey | UXEJJLLXKVUJDC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|