C13H24N2OSi — CID 71429023
5-[[tert-butyl(dimethyl)silyl]oxymethyl]benzene-1,3-diamine (PubChem CID 71429023) has the molecular formula C13H24N2OSi and a molecular weight of 252.43 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]benzene-1,3-diamine.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 71429023 |
| Molecular Formula | C13H24N2OSi |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]benzene-1,3-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(N)cc(N)c1 |
| InChI | InChI=1S/C13H24N2OSi/c1-13(2,3)17(4,5)16-9-10-6-11(14)8-12(15)7-10/h6-8H,9,14-15H2,1-5H3 |
| InChIKey | BXHWFTGEQXIWEK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|