C19H34BNO3Si — CID 90105259
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 90105259) has the molecular formula C19H34BNO3Si and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 90105259 |
| Molecular Formula | C19H34BNO3Si |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc(N)cc(CO[Si](C)(C)C(C)(C)C)c2)OC1(C)C |
| InChI | InChI=1S/C19H34BNO3Si/c1-17(2,3)25(8,9)22-13-14-10-15(12-16(21)11-14)20-23-18(4,5)19(6,7)24-20/h10-12H,13,21H2,1-9H3 |
| InChIKey | JFSLACGVEMYWLS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|