C16H30BNO3SSi — CID 175653948
tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methoxy]silane (PubChem CID 175653948) has the molecular formula C16H30BNO3SSi and a molecular weight of 355.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 175653948 |
| Molecular Formula | C16H30BNO3SSi |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]methoxy]silane |
| SMILES | CC1(C)OB(c2csc(CO[Si](C)(C)C(C)(C)C)n2)OC1(C)C |
| InChI | InChI=1S/C16H30BNO3SSi/c1-14(2,3)23(8,9)19-10-13-18-12(11-22-13)17-20-15(4,5)16(6,7)21-17/h11H,10H2,1-9H3 |
| InChIKey | HUCMLQQXLABOFS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|