C21H39BO5Si — CID 135396600
[(3aS,6R,6aR)-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 135396600) has the molecular formula C21H39BO5Si and a molecular weight of 410.44 g/mol. Its IUPAC name is [(3aS,6R,6aR)-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,6R,6aR)-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135396600 |
| Molecular Formula | C21H39BO5Si |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | [(3aS,6R,6aR)-2,2-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C=C(B3OC(C)(C)C(C)(C)O3)[C@@H]2O1 |
| InChI | InChI=1S/C21H39BO5Si/c1-18(2,3)28(10,11)23-13-14-12-15(17-16(14)24-21(8,9)25-17)22-26-19(4,5)20(6,7)27-22/h12,14,16-17H,13H2,1-11H3/t14-,16-,17+/m1/s1 |
| InChIKey | FDCFBQHLRBVOMG-OIISXLGYSA-N |
| XLogP | 4.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|