C26H42O6SSi — CID 102396780
[(4R,5S)-5-[(3aR,4R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102396780) has the molecular formula C26H42O6SSi and a molecular weight of 510.77 g/mol. Its IUPAC name is [(4R,5S)-5-[(3aR,4R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,5S)-5-[(3aR,4R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102396780 |
| Molecular Formula | C26H42O6SSi |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | [(4R,5S)-5-[(3aR,4R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]([C@@H]2OC(Sc3ccccc3)C[C@H]3OC(C)(C)O[C@@H]23)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H42O6SSi/c1-24(2,3)34(8,9)27-16-19-22(32-26(6,7)30-19)23-21-18(29-25(4,5)31-21)15-20(28-23)33-17-13-11-10-12-14-17/h10-14,18-23H,15-16H2,1-9H3/t18-,19-,20?,21-,22+,23-/m1/s1 |
| InChIKey | GQYXAUNZTLQZPM-HLMQGGIYSA-N |
| XLogP | 5.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|