C24H44O3SSi2 — CID 135022444
tert-butyl-[(4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane (PubChem CID 135022444) has the molecular formula C24H44O3SSi2 and a molecular weight of 468.85 g/mol. Its IUPAC name is tert-butyl-[(4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135022444 |
| Molecular Formula | C24H44O3SSi2 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl-[(4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-dimethylsilane |
| SMILES | CC1O[C@@H](Sc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3SSi2/c1-18-22(27-30(10,11)24(5,6)7)20(26-29(8,9)23(2,3)4)17-21(25-18)28-19-15-13-12-14-16-19/h12-16,18,20-22H,17H2,1-11H3/t18?,20-,21+,22?/m1/s1 |
| InChIKey | FPVSCADEUYUYQI-SGCCOESXSA-N |
| XLogP | 7.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|