C20H35NO2SSi — CID 101101693
(2S,3R,4S)-N,N,2-trimethyl-6-phenylsulfanyl-4-triethylsilyloxyoxan-3-amine (PubChem CID 101101693) has the molecular formula C20H35NO2SSi and a molecular weight of 381.66 g/mol. Its IUPAC name is (2S,3R,4S)-N,N,2-trimethyl-6-phenylsulfanyl-4-triethylsilyloxyoxan-3-amine.
| Compound Name | (2S,3R,4S)-N,N,2-trimethyl-6-phenylsulfanyl-4-triethylsilyloxyoxan-3-amine |
|---|---|
| PubChem CID | 101101693 |
| Molecular Formula | C20H35NO2SSi |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (2S,3R,4S)-N,N,2-trimethyl-6-phenylsulfanyl-4-triethylsilyloxyoxan-3-amine |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(Sc2ccccc2)O[C@@H](C)[C@H]1N(C)C |
| InChI | InChI=1S/C20H35NO2SSi/c1-7-25(8-2,9-3)23-18-15-19(22-16(4)20(18)21(5)6)24-17-13-11-10-12-14-17/h10-14,16,18-20H,7-9,15H2,1-6H3/t16-,18-,19?,20+/m0/s1 |
| InChIKey | NAUNNUCBGMKUQC-UDLHLFEOSA-N |
| XLogP | 5.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|