C16H25O5PS — CID 10893744
[(2S,3S)-3-(diethoxyphosphorylmethyl)-5-phenylsulfanyloxolan-2-yl]methanol (PubChem CID 10893744) has the molecular formula C16H25O5PS and a molecular weight of 360.41 g/mol. Its IUPAC name is [(2S,3S)-3-(diethoxyphosphorylmethyl)-5-phenylsulfanyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S)-3-(diethoxyphosphorylmethyl)-5-phenylsulfanyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10893744 |
| Molecular Formula | C16H25O5PS |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(2S,3S)-3-(diethoxyphosphorylmethyl)-5-phenylsulfanyloxolan-2-yl]methanol |
| SMILES | CCOP(=O)(C[C@H]1CC(Sc2ccccc2)O[C@@H]1CO)OCC |
| InChI | InChI=1S/C16H25O5PS/c1-3-19-22(18,20-4-2)12-13-10-16(21-15(13)11-17)23-14-8-6-5-7-9-14/h5-9,13,15-17H,3-4,10-12H2,1-2H3/t13-,15-,16?/m1/s1 |
| InChIKey | ZOKPTUAJUVEXBU-CWSLVUQWSA-N |
| XLogP | 3.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|