C19H25O10PS — CID 102156788
methyl-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]methoxy]phosphinic acid (PubChem CID 102156788) has the molecular formula C19H25O10PS and a molecular weight of 476.44 g/mol. Its IUPAC name is methyl-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]methoxy]phosphinic acid.
| Compound Name | methyl-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 102156788 |
| Molecular Formula | C19H25O10PS |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | methyl-[[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]methoxy]phosphinic acid |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](Sc2ccccc2)O[C@H](COP(C)(=O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H25O10PS/c1-11(20)26-16-15(10-25-30(4,23)24)29-19(31-14-8-6-5-7-9-14)18(28-13(3)22)17(16)27-12(2)21/h5-9,15-19H,10H2,1-4H3,(H,23,24)/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | ZPLCGEXHKKDFAL-ICBNADEASA-N |
| XLogP | 2.13 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|