C20H34O6P2 — CID 101053260
[(1S,2S,3R)-2-diethoxyphosphoryl-3-(diethoxyphosphorylmethyl)cyclopentyl]benzene (PubChem CID 101053260) has the molecular formula C20H34O6P2 and a molecular weight of 432.43 g/mol. Its IUPAC name is [(1S,2S,3R)-2-diethoxyphosphoryl-3-(diethoxyphosphorylmethyl)cyclopentyl]benzene.
| Compound Name | [(1S,2S,3R)-2-diethoxyphosphoryl-3-(diethoxyphosphorylmethyl)cyclopentyl]benzene |
|---|---|
| PubChem CID | 101053260 |
| Molecular Formula | C20H34O6P2 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(1S,2S,3R)-2-diethoxyphosphoryl-3-(diethoxyphosphorylmethyl)cyclopentyl]benzene |
| SMILES | CCOP(=O)(C[C@H]1CC[C@@H](c2ccccc2)[C@@H]1P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C20H34O6P2/c1-5-23-27(21,24-6-2)16-18-14-15-19(17-12-10-9-11-13-17)20(18)28(22,25-7-3)26-8-4/h9-13,18-20H,5-8,14-16H2,1-4H3/t18-,19+,20-/m1/s1 |
| InChIKey | HQLLQLSAFOUVII-HSALFYBXSA-N |
| XLogP | 6.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|