C19H29O6P — CID 102285624
ethyl (1S,2R,3R,6R)-3-diethoxyphosphoryl-2-hydroxy-6-phenylcyclohexane-1-carboxylate (PubChem CID 102285624) has the molecular formula C19H29O6P and a molecular weight of 384.41 g/mol. Its IUPAC name is ethyl (1S,2R,3R,6R)-3-diethoxyphosphoryl-2-hydroxy-6-phenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,6R)-3-diethoxyphosphoryl-2-hydroxy-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102285624 |
| Molecular Formula | C19H29O6P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethyl (1S,2R,3R,6R)-3-diethoxyphosphoryl-2-hydroxy-6-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](O)[C@H](P(=O)(OCC)OCC)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H29O6P/c1-4-23-19(21)17-15(14-10-8-7-9-11-14)12-13-16(18(17)20)26(22,24-5-2)25-6-3/h7-11,15-18,20H,4-6,12-13H2,1-3H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | WAABGDUGPLJIJL-MHORFTMASA-N |
| XLogP | 3.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|