C17H22O3 — CID 102302294
ethyl (4bS,8aS,9R,10R)-10-hydroxy-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-9-carboxylate (PubChem CID 102302294) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (4bS,8aS,9R,10R)-10-hydroxy-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-9-carboxylate.
| Compound Name | ethyl (4bS,8aS,9R,10R)-10-hydroxy-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-9-carboxylate |
|---|---|
| PubChem CID | 102302294 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | ethyl (4bS,8aS,9R,10R)-10-hydroxy-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCCC[C@@H]2c2ccccc2[C@@H]1O |
| InChI | InChI=1S/C17H22O3/c1-2-20-17(19)15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)16(15)18/h4,6,8,10-11,13,15-16,18H,2-3,5,7,9H2,1H3/t11-,13+,15-,16+/m1/s1 |
| InChIKey | JRXSORQGZAQTLB-JMGFVUJMSA-N |
| XLogP | 3.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |