C13H15NO3 — CID 58646728
ethyl (1S,8S,9S,10S)-10-amino-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate (PubChem CID 58646728) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is ethyl (1S,8S,9S,10S)-10-amino-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate.
| Compound Name | ethyl (1S,8S,9S,10S)-10-amino-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 58646728 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethyl (1S,8S,9S,10S)-10-amino-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](N)[C@H]2O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C13H15NO3/c1-2-16-13(15)9-10(14)12-8-6-4-3-5-7(8)11(9)17-12/h3-6,9-12H,2,14H2,1H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | HUGRGOHFBGSCIN-YFKTTZPYSA-N |
| XLogP | 1.32 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |