C19H20O2 — CID 77467095
ethyl 2-(2-methylphenyl)-3-phenylcyclopropane-1-carboxylate (PubChem CID 77467095) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl 2-(2-methylphenyl)-3-phenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(2-methylphenyl)-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 77467095 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethyl 2-(2-methylphenyl)-3-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C1c1ccccc1C |
| InChI | InChI=1S/C19H20O2/c1-3-21-19(20)18-16(14-10-5-4-6-11-14)17(18)15-12-8-7-9-13(15)2/h4-12,16-18H,3H2,1-2H3 |
| InChIKey | LZVNKDWWVQDXTF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |