C19H18O4S — CID 101262822
ethyl (2R,3S)-5-oxo-2-phenyl-4-phenylsulfanyloxolane-3-carboxylate (PubChem CID 101262822) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl (2R,3S)-5-oxo-2-phenyl-4-phenylsulfanyloxolane-3-carboxylate.
| Compound Name | ethyl (2R,3S)-5-oxo-2-phenyl-4-phenylsulfanyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 101262822 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | ethyl (2R,3S)-5-oxo-2-phenyl-4-phenylsulfanyloxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(Sc2ccccc2)C(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18O4S/c1-2-22-18(20)15-16(13-9-5-3-6-10-13)23-19(21)17(15)24-14-11-7-4-8-12-14/h3-12,15-17H,2H2,1H3/t15-,16+,17?/m1/s1 |
| InChIKey | HOTDCXKMOJGOKL-GARXDOFDSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |