C13H16O3S — CID 101458998
ethyl (2S,4S)-4-phenylsulfanyloxolane-2-carboxylate (PubChem CID 101458998) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is ethyl (2S,4S)-4-phenylsulfanyloxolane-2-carboxylate.
| Compound Name | ethyl (2S,4S)-4-phenylsulfanyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 101458998 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | ethyl (2S,4S)-4-phenylsulfanyloxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](Sc2ccccc2)CO1 |
| InChI | InChI=1S/C13H16O3S/c1-2-15-13(14)12-8-11(9-16-12)17-10-6-4-3-5-7-10/h3-7,11-12H,2,8-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | DOANRSHFSOQTFC-RYUDHWBXSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |