C20H22O5 — CID 66677365
benzyl (4R)-5-hydroxy-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 66677365) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is benzyl (4R)-5-hydroxy-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | benzyl (4R)-5-hydroxy-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 66677365 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | benzyl (4R)-5-hydroxy-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C[C@@H](OCc2ccccc2)C(O)CO1 |
| InChI | InChI=1S/C20H22O5/c21-17-14-24-19(20(22)25-13-16-9-5-2-6-10-16)11-18(17)23-12-15-7-3-1-4-8-15/h1-10,17-19,21H,11-14H2/t17?,18-,19?/m1/s1 |
| InChIKey | STXPECJJCZIXJU-JLAWEPINSA-N |
| XLogP | 2.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |