C33H40O5 — CID 163758645
benzyl (2S,4S,5S,7S)-7-butan-2-yl-4,5-bis(phenylmethoxy)oxocane-2-carboxylate (PubChem CID 163758645) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is benzyl (2S,4S,5S,7S)-7-butan-2-yl-4,5-bis(phenylmethoxy)oxocane-2-carboxylate.
| Compound Name | benzyl (2S,4S,5S,7S)-7-butan-2-yl-4,5-bis(phenylmethoxy)oxocane-2-carboxylate |
|---|---|
| PubChem CID | 163758645 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | benzyl (2S,4S,5S,7S)-7-butan-2-yl-4,5-bis(phenylmethoxy)oxocane-2-carboxylate |
| SMILES | CCC(C)[C@@H]1CO[C@H](C(=O)OCc2ccccc2)C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C33H40O5/c1-3-25(2)29-19-30(35-21-26-13-7-4-8-14-26)31(36-22-27-15-9-5-10-16-27)20-32(37-24-29)33(34)38-23-28-17-11-6-12-18-28/h4-18,25,29-32H,3,19-24H2,1-2H3/t25?,29-,30-,31-,32-/m0/s1 |
| InChIKey | LWGKJJKCAOORJD-RHBTWBPOSA-N |
| XLogP | 6.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |