benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate

C12H13NO4 — CID 14443169

IUPACbenzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate
SMILESCN1C[C@@H](C(=O)OCc2ccccc2)OC1=O
InChIInChI=1S/C12H13NO4/c1-13-7-10(17-12(13)15)11(14)16-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1
InChIKeyZEQCAOVLVRAHFN-JTQLQIEISA-N
MW235.24 g/mol
LogP1.18
Rot. Bonds3

About benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate

benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 14443169) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate.

Molecular Properties

Compound Namebenzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate
PubChem CID14443169
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Namebenzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate
SMILESCN1C[C@@H](C(=O)OCc2ccccc2)OC1=O
InChIInChI=1S/C12H13NO4/c1-13-7-10(17-12(13)15)11(14)16-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1
InChIKeyZEQCAOVLVRAHFN-JTQLQIEISA-N
XLogP1.18
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate?
The IUPAC name of benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate (CID 14443169) is benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate.
What is the SMILES notation for benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate?
The canonical SMILES for benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate is CN1C[C@@H](C(=O)OCc2ccccc2)OC1=O.
What is the InChIKey of benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate?
The InChIKey is ZEQCAOVLVRAHFN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13NO4/c1-13-7-10(17-12(13)15)11(14)16-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1.
What are the key properties of benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate?
benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate has a molecular weight of 235.24 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (5S)-3-methyl-2-oxo-1,3-oxazolidine-5-carboxylate is sourced from PubChem (CID 14443169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).