C15H17NO6 — CID 18352599
4-O-benzyl 3-O-ethyl 5-methyl-2-oxo-1,3-oxazolidine-3,4-dicarboxylate (PubChem CID 18352599) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 4-O-benzyl 3-O-ethyl 5-methyl-2-oxo-1,3-oxazolidine-3,4-dicarboxylate.
| Compound Name | 4-O-benzyl 3-O-ethyl 5-methyl-2-oxo-1,3-oxazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 18352599 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-O-benzyl 3-O-ethyl 5-methyl-2-oxo-1,3-oxazolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)N1C(=O)OC(C)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO6/c1-3-20-14(18)16-12(10(2)22-15(16)19)13(17)21-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3 |
| InChIKey | WUQAYXZVDCOUPE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|