C14H19NO2 — CID 10633400
benzyl (2S,3S)-3-methyl-1-propan-2-ylaziridine-2-carboxylate (PubChem CID 10633400) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is benzyl (2S,3S)-3-methyl-1-propan-2-ylaziridine-2-carboxylate.
| Compound Name | benzyl (2S,3S)-3-methyl-1-propan-2-ylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10633400 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | benzyl (2S,3S)-3-methyl-1-propan-2-ylaziridine-2-carboxylate |
| SMILES | CC(C)N1[C@H](C(=O)OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C14H19NO2/c1-10(2)15-11(3)13(15)14(16)17-9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3/t11-,13-,15?/m0/s1 |
| InChIKey | WIRVDGUTKMLSMY-HEIKZBPMSA-N |
| XLogP | 2.21 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|