benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate

C15H18N2O4 — CID 156547897

IUPACbenzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate
SMILESCC1C(=O)N(C)C(=O)N(C)C1C(=O)OCc1ccccc1
InChIInChI=1S/C15H18N2O4/c1-10-12(16(2)15(20)17(3)13(10)18)14(19)21-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3
InChIKeyRHSCKTJJYBCRQC-UHFFFAOYSA-N
MW290.32 g/mol
LogP1.26
Rot. Bonds3

About benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate

benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate (PubChem CID 156547897) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate.

Molecular Properties

Compound Namebenzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate
PubChem CID156547897
Molecular FormulaC15H18N2O4
Molecular Weight290.32 g/mol
Exact Mass290.13
IUPAC Namebenzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate
SMILESCC1C(=O)N(C)C(=O)N(C)C1C(=O)OCc1ccccc1
InChIInChI=1S/C15H18N2O4/c1-10-12(16(2)15(20)17(3)13(10)18)14(19)21-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3
InChIKeyRHSCKTJJYBCRQC-UHFFFAOYSA-N
XLogP1.26
TPSA66.92 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.32
LogP ≤ 51.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate?
The IUPAC name of benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate (CID 156547897) is benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate.
What is the SMILES notation for benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate?
The canonical SMILES for benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate is CC1C(=O)N(C)C(=O)N(C)C1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate?
The InChIKey is RHSCKTJJYBCRQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-10-12(16(2)15(20)17(3)13(10)18)14(19)21-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3.
What are the key properties of benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate?
benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate has a molecular weight of 290.32 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate is sourced from PubChem (CID 156547897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).