C15H18N2O4 — CID 156547897
benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate (PubChem CID 156547897) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate.
| Compound Name | benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 156547897 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | benzyl 1,3,5-trimethyl-2,6-dioxo-1,3-diazinane-4-carboxylate |
| SMILES | CC1C(=O)N(C)C(=O)N(C)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18N2O4/c1-10-12(16(2)15(20)17(3)13(10)18)14(19)21-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3 |
| InChIKey | RHSCKTJJYBCRQC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |