C14H17NO2 — CID 169070000
benzyl (2R,3R)-3-cyclopropyl-3-deuterio-1-methylaziridine-2-carboxylate (PubChem CID 169070000) has the molecular formula C14H17NO2 and a molecular weight of 232.30 g/mol. Its IUPAC name is benzyl (2R,3R)-3-cyclopropyl-3-deuterio-1-methylaziridine-2-carboxylate.
| Compound Name | benzyl (2R,3R)-3-cyclopropyl-3-deuterio-1-methylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 169070000 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | benzyl (2R,3R)-3-cyclopropyl-3-deuterio-1-methylaziridine-2-carboxylate |
| SMILES | [2H][C@@]1(C2CC2)[C@H](C(=O)OCc2ccccc2)N1C |
| InChI | InChI=1S/C14H17NO2/c1-15-12(11-7-8-11)13(15)14(16)17-9-10-5-3-2-4-6-10/h2-6,11-13H,7-9H2,1H3/t12-,13-,15?/m1/s1/i12D |
| InChIKey | BBJNZKBVWBRVTA-LHNVRSBGSA-N |
| XLogP | 1.82 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|