benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate

C21H25NO2 — CID 77462570

IUPACbenzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate
SMILESCC1CCN(C(C)c2ccccc2)C1C(=O)OCc1ccccc1
InChIInChI=1S/C21H25NO2/c1-16-13-14-22(17(2)19-11-7-4-8-12-19)20(16)21(23)24-15-18-9-5-3-6-10-18/h3-12,16-17,20H,13-15H2,1-2H3
InChIKeySQTLAFZBZQHYPE-UHFFFAOYSA-N
MW323.44 g/mol
LogP4.20
Rot. Bonds5

About benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate

benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate (PubChem CID 77462570) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namebenzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate
PubChem CID77462570
Molecular FormulaC21H25NO2
Molecular Weight323.44 g/mol
Exact Mass323.19
IUPAC Namebenzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate
SMILESCC1CCN(C(C)c2ccccc2)C1C(=O)OCc1ccccc1
InChIInChI=1S/C21H25NO2/c1-16-13-14-22(17(2)19-11-7-4-8-12-19)20(16)21(23)24-15-18-9-5-3-6-10-18/h3-12,16-17,20H,13-15H2,1-2H3
InChIKeySQTLAFZBZQHYPE-UHFFFAOYSA-N
XLogP4.20
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.44
LogP ≤ 54.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate?
The IUPAC name of benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate (CID 77462570) is benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate?
The canonical SMILES for benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate is CC1CCN(C(C)c2ccccc2)C1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate?
The InChIKey is SQTLAFZBZQHYPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-16-13-14-22(17(2)19-11-7-4-8-12-19)20(16)21(23)24-15-18-9-5-3-6-10-18/h3-12,16-17,20H,13-15H2,1-2H3.
What are the key properties of benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate?
benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate has a molecular weight of 323.44 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-methyl-1-(1-phenylethyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 77462570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).