C21H22N2O3 — CID 2794054
benzyl 1,3,6-trimethyl-2-oxo-4-phenyl-4H-pyrimidine-5-carboxylate (PubChem CID 2794054) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is benzyl 1,3,6-trimethyl-2-oxo-4-phenyl-4H-pyrimidine-5-carboxylate.
| Compound Name | benzyl 1,3,6-trimethyl-2-oxo-4-phenyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2794054 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | benzyl 1,3,6-trimethyl-2-oxo-4-phenyl-4H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccccc2)N(C)C(=O)N1C |
| InChI | InChI=1S/C21H22N2O3/c1-15-18(20(24)26-14-16-10-6-4-7-11-16)19(17-12-8-5-9-13-17)23(3)21(25)22(15)2/h4-13,19H,14H2,1-3H3 |
| InChIKey | JNRAVYLVNPXRLZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |