C24H19NO4 — CID 54702886
benzyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate (PubChem CID 54702886) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is benzyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate.
| Compound Name | benzyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54702886 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | benzyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=C(O)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C24H19NO4/c26-22-20(24(28)29-16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)25(23(22)27)19-14-8-3-9-15-19/h1-15,21,26H,16H2 |
| InChIKey | DUMGPXLDFKIPQN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |