C18H15NO4 — CID 54736162
methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate (PubChem CID 54736162) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54736162 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C18H15NO4/c1-23-18(22)14-15(12-8-4-2-5-9-12)19(17(21)16(14)20)13-10-6-3-7-11-13/h2-11,15,20H,1H3 |
| InChIKey | DZVGELJCXDRKPZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |