methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate

C18H15NO4 — CID 54736162

IUPACmethyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate
SMILESCOC(=O)C1=C(O)C(=O)N(c2ccccc2)C1c1ccccc1
InChIInChI=1S/C18H15NO4/c1-23-18(22)14-15(12-8-4-2-5-9-12)19(17(21)16(14)20)13-10-6-3-7-11-13/h2-11,15,20H,1H3
InChIKeyDZVGELJCXDRKPZ-UHFFFAOYSA-N
MW309.32 g/mol
LogP2.76
Rot. Bonds3

About methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate

methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate (PubChem CID 54736162) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate
PubChem CID54736162
Molecular FormulaC18H15NO4
Molecular Weight309.32 g/mol
Exact Mass309.10
IUPAC Namemethyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate
SMILESCOC(=O)C1=C(O)C(=O)N(c2ccccc2)C1c1ccccc1
InChIInChI=1S/C18H15NO4/c1-23-18(22)14-15(12-8-4-2-5-9-12)19(17(21)16(14)20)13-10-6-3-7-11-13/h2-11,15,20H,1H3
InChIKeyDZVGELJCXDRKPZ-UHFFFAOYSA-N
XLogP2.76
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.32
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate?
The IUPAC name of methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate (CID 54736162) is methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate.
What is the SMILES notation for methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate?
The canonical SMILES for methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate is COC(=O)C1=C(O)C(=O)N(c2ccccc2)C1c1ccccc1.
What is the InChIKey of methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate?
The InChIKey is DZVGELJCXDRKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4/c1-23-18(22)14-15(12-8-4-2-5-9-12)19(17(21)16(14)20)13-10-6-3-7-11-13/h2-11,15,20H,1H3.
What are the key properties of methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate?
methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate has a molecular weight of 309.32 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-5-oxo-1,2-diphenyl-2H-pyrrole-3-carboxylate is sourced from PubChem (CID 54736162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).